About 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol
2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol (PubChem CID 149384524) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol |
| PubChem CID | 149384524 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol |
| SMILES | CC(N)C1C=CCC(C(F)(F)CO)C1 |
| InChI | InChI=1S/C10H17F2NO/c1-7(13)8-3-2-4-9(5-8)10(11,12)6-14/h2-3,7-9,14H,4-6,13H2,1H3 |
| InChIKey | YMHWNXOIEDTXGI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol?
The IUPAC name of 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol (CID 149384524) is 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol.
What is the SMILES notation for 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol?
The canonical SMILES for 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol is CC(N)C1C=CCC(C(F)(F)CO)C1.
What is the InChIKey of 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol?
The InChIKey is YMHWNXOIEDTXGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO/c1-7(13)8-3-2-4-9(5-8)10(11,12)6-14/h2-3,7-9,14H,4-6,13H2,1H3.
What are the key properties of 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol?
2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol has a molecular weight of 205.25 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1-aminoethyl)cyclohex-3-en-1-yl]-2,2-difluoroethanol is sourced from PubChem (CID 149384524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).