About (3,5-ditert-butylphenyl) trifluoromethanesulfonate
(3,5-ditert-butylphenyl) trifluoromethanesulfonate (PubChem CID 14938656) has the molecular formula C15H21F3O3S
and a molecular weight of 338.39 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3,5-ditert-butylphenyl) trifluoromethanesulfonate |
| PubChem CID | 14938656 |
| Molecular Formula | C15H21F3O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (3,5-ditert-butylphenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc(OS(=O)(=O)C(F)(F)F)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H21F3O3S/c1-13(2,3)10-7-11(14(4,5)6)9-12(8-10)21-22(19,20)15(16,17)18/h7-9H,1-6H3 |
| InChIKey | NMKZEDAODGHHEC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3,5-ditert-butylphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-ditert-butylphenyl) trifluoromethanesulfonate?
The IUPAC name of (3,5-ditert-butylphenyl) trifluoromethanesulfonate (CID 14938656) is (3,5-ditert-butylphenyl) trifluoromethanesulfonate.
What is the SMILES notation for (3,5-ditert-butylphenyl) trifluoromethanesulfonate?
The canonical SMILES for (3,5-ditert-butylphenyl) trifluoromethanesulfonate is CC(C)(C)c1cc(OS(=O)(=O)C(F)(F)F)cc(C(C)(C)C)c1.
What is the InChIKey of (3,5-ditert-butylphenyl) trifluoromethanesulfonate?
The InChIKey is NMKZEDAODGHHEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3O3S/c1-13(2,3)10-7-11(14(4,5)6)9-12(8-10)21-22(19,20)15(16,17)18/h7-9H,1-6H3.
What are the key properties of (3,5-ditert-butylphenyl) trifluoromethanesulfonate?
(3,5-ditert-butylphenyl) trifluoromethanesulfonate has a molecular weight of 338.39 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-ditert-butylphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 14938656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).