C19H24N7O10PS — CID 149387021
1-[(2R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 149387021) has the molecular formula C19H24N7O10PS and a molecular weight of 573.48 g/mol. Its IUPAC name is 1-[(2R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 149387021 |
| Molecular Formula | C19H24N7O10PS |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | 1-[(2R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COC1C(OP(O)(=S)O[C@H]2O[C@@H](n3cnc4c(N)ncnc43)CC2O)[C@@H](CO)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24N7O10PS/c1-32-14-13(9(5-27)33-17(14)25-3-2-10(29)24-19(25)30)35-37(31,38)36-18-8(28)4-11(34-18)26-7-23-12-15(20)21-6-22-16(12)26/h2-3,6-9,11,13-14,17-18,27-28H,4-5H2,1H3,(H,31,38)(H2,20,21,22)(H,24,29,30)/t8?,9-,11-,13?,14?,17-,18-,37?/m1/s1 |
| InChIKey | YMUARUVVCSONDI-QMYGMCPTSA-N |
| XLogP | -1.91 |
| TPSA | 231.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|