About 2-aminopropyl 4-bromo-2-fluorobenzoate
2-aminopropyl 4-bromo-2-fluorobenzoate (PubChem CID 149387254) has the molecular formula C10H11BrFNO2
and a molecular weight of 276.11 g/mol. Its IUPAC name is 2-aminopropyl 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | 2-aminopropyl 4-bromo-2-fluorobenzoate |
| PubChem CID | 149387254 |
| Molecular Formula | C10H11BrFNO2 |
| Molecular Weight | 276.11 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-aminopropyl 4-bromo-2-fluorobenzoate |
| SMILES | CC(N)COC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C10H11BrFNO2/c1-6(13)5-15-10(14)8-3-2-7(11)4-9(8)12/h2-4,6H,5,13H2,1H3 |
| InChIKey | YMVFIMYTJCBEEX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminopropyl 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropyl 4-bromo-2-fluorobenzoate?
The IUPAC name of 2-aminopropyl 4-bromo-2-fluorobenzoate (CID 149387254) is 2-aminopropyl 4-bromo-2-fluorobenzoate.
What is the SMILES notation for 2-aminopropyl 4-bromo-2-fluorobenzoate?
The canonical SMILES for 2-aminopropyl 4-bromo-2-fluorobenzoate is CC(N)COC(=O)c1ccc(Br)cc1F.
What is the InChIKey of 2-aminopropyl 4-bromo-2-fluorobenzoate?
The InChIKey is YMVFIMYTJCBEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrFNO2/c1-6(13)5-15-10(14)8-3-2-7(11)4-9(8)12/h2-4,6H,5,13H2,1H3.
What are the key properties of 2-aminopropyl 4-bromo-2-fluorobenzoate?
2-aminopropyl 4-bromo-2-fluorobenzoate has a molecular weight of 276.11 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropyl 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 149387254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).