About 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one
6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one (PubChem CID 14938781) has the molecular formula C14H8FNO2S
and a molecular weight of 273.29 g/mol. Its IUPAC name is 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one |
| PubChem CID | 14938781 |
| Molecular Formula | C14H8FNO2S |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one |
| SMILES | O=C(c1ccc2[nH]c(=O)sc2c1)c1ccccc1F |
| InChI | InChI=1S/C14H8FNO2S/c15-10-4-2-1-3-9(10)13(17)8-5-6-11-12(7-8)19-14(18)16-11/h1-7H,(H,16,18) |
| InChIKey | GGLMUUGNMFCDFW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one?
The IUPAC name of 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one (CID 14938781) is 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one?
The canonical SMILES for 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one is O=C(c1ccc2[nH]c(=O)sc2c1)c1ccccc1F.
What is the InChIKey of 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one?
The InChIKey is GGLMUUGNMFCDFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8FNO2S/c15-10-4-2-1-3-9(10)13(17)8-5-6-11-12(7-8)19-14(18)16-11/h1-7H,(H,16,18).
What are the key properties of 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one?
6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one has a molecular weight of 273.29 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluorobenzoyl)-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 14938781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).