C13H13N3O5 — CID 14938805
7a-ethoxy-3-(4-nitrophenyl)-6,7-dihydropyrrolo[1,2-d][1,2,4]oxadiazol-5-one (PubChem CID 14938805) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 7a-ethoxy-3-(4-nitrophenyl)-6,7-dihydropyrrolo[1,2-d][1,2,4]oxadiazol-5-one.
| Compound Name | 7a-ethoxy-3-(4-nitrophenyl)-6,7-dihydropyrrolo[1,2-d][1,2,4]oxadiazol-5-one |
|---|---|
| PubChem CID | 14938805 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 7a-ethoxy-3-(4-nitrophenyl)-6,7-dihydropyrrolo[1,2-d][1,2,4]oxadiazol-5-one |
| SMILES | CCOC12CCC(=O)N1C(c1ccc([N+](=O)[O-])cc1)=NO2 |
| InChI | InChI=1S/C13H13N3O5/c1-2-20-13-8-7-11(17)15(13)12(14-21-13)9-3-5-10(6-4-9)16(18)19/h3-6H,2,7-8H2,1H3 |
| InChIKey | TXAXHHRMZLMVNU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|