About 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline
5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline (PubChem CID 149388517) has the molecular formula C18H27F2N3O
and a molecular weight of 339.43 g/mol. Its IUPAC name is 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline.
Molecular Properties
| Compound Name | 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline |
| PubChem CID | 149388517 |
| Molecular Formula | C18H27F2N3O |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline |
| SMILES | [H]/N=C(\C)c1c(C)cc(OCC2CCN(C(C)C(F)F)CC2)cc1N |
| InChI | InChI=1S/C18H27F2N3O/c1-11-8-15(9-16(22)17(11)12(2)21)24-10-14-4-6-23(7-5-14)13(3)18(19)20/h8-9,13-14,18,21H,4-7,10,22H2,1-3H3/b21-12+ |
| InChIKey | YNBILRSUIWOETK-CIAFOILYSA-N |
| XLogP | 3.71 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline?
The IUPAC name of 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline (CID 149388517) is 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline.
What is the SMILES notation for 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline?
The canonical SMILES for 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline is [H]/N=C(\C)c1c(C)cc(OCC2CCN(C(C)C(F)F)CC2)cc1N.
What is the InChIKey of 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline?
The InChIKey is YNBILRSUIWOETK-CIAFOILYSA-N. The full InChI is InChI=1S/C18H27F2N3O/c1-11-8-15(9-16(22)17(11)12(2)21)24-10-14-4-6-23(7-5-14)13(3)18(19)20/h8-9,13-14,18,21H,4-7,10,22H2,1-3H3/b21-12+.
What are the key properties of 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline?
5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline has a molecular weight of 339.43 g/mol, XLogP of 3.71, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-2-ethanimidoyl-3-methylaniline is sourced from PubChem (CID 149388517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).