About (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene
(1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene (PubChem CID 149388783) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene.
Molecular Properties
| Compound Name | (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene |
| PubChem CID | 149388783 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene |
| SMILES | CC[C@H]1CC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C13H18/c1-4-10-9-13(2,3)12-8-6-5-7-11(10)12/h5-8,10H,4,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | YNCQNHTXCMGWKS-JTQLQIEISA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene?
The IUPAC name of (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene (CID 149388783) is (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene.
What is the SMILES notation for (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene?
The canonical SMILES for (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene is CC[C@H]1CC(C)(C)c2ccccc21.
What is the InChIKey of (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene?
The InChIKey is YNCQNHTXCMGWKS-JTQLQIEISA-N. The full InChI is InChI=1S/C13H18/c1-4-10-9-13(2,3)12-8-6-5-7-11(10)12/h5-8,10H,4,9H2,1-3H3/t10-/m0/s1.
What are the key properties of (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene?
(1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene has a molecular weight of 174.29 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-ethyl-3,3-dimethyl-1,2-dihydroindene is sourced from PubChem (CID 149388783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).