About 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole
6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole (PubChem CID 149388956) has the molecular formula C8H8F2N2
and a molecular weight of 170.16 g/mol. Its IUPAC name is 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole |
| PubChem CID | 149388956 |
| Molecular Formula | C8H8F2N2 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole |
| SMILES | Cc1nc2c([nH]1)C(F)C(F)C=C2 |
| InChI | InChI=1S/C8H8F2N2/c1-4-11-6-3-2-5(9)7(10)8(6)12-4/h2-3,5,7H,1H3,(H,11,12) |
| InChIKey | YNDNGKUVCPLWOJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole?
The IUPAC name of 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole (CID 149388956) is 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole.
What is the SMILES notation for 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole?
The canonical SMILES for 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole is Cc1nc2c([nH]1)C(F)C(F)C=C2.
What is the InChIKey of 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole?
The InChIKey is YNDNGKUVCPLWOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N2/c1-4-11-6-3-2-5(9)7(10)8(6)12-4/h2-3,5,7H,1H3,(H,11,12).
What are the key properties of 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole?
6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole has a molecular weight of 170.16 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-2-methyl-6,7-dihydro-1H-benzimidazole is sourced from PubChem (CID 149388956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).