C29H24F3N7O3 — CID 149389246
9-[6-(2-oxopropyl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 149389246) has the molecular formula C29H24F3N7O3 and a molecular weight of 575.55 g/mol. Its IUPAC name is 9-[6-(2-oxopropyl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-[6-(2-oxopropyl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 149389246 |
| Molecular Formula | C29H24F3N7O3 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 9-[6-(2-oxopropyl)-3-pyridinyl]-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | CC(=O)Cc1ccc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5ccc(N6CCNCC6)c(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C29H24F3N7O3/c1-16(40)12-18-3-2-17(14-34-18)22-5-6-23-25(36-22)26-20(15-35-23)27(41)37-28(42)39(26)19-4-7-24(21(13-19)29(30,31)32)38-10-8-33-9-11-38/h2-7,13-15,33H,8-12H2,1H3,(H,37,41,42) |
| InChIKey | YNEXRGGMADHNBY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|