C23H24F5NO5 — CID 14938942
(2,3,4,5,6-pentafluorophenyl) 5-(2,2-diethoxyethylamino)-5-oxo-3-phenylpentanoate (PubChem CID 14938942) has the molecular formula C23H24F5NO5 and a molecular weight of 489.44 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-(2,2-diethoxyethylamino)-5-oxo-3-phenylpentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-(2,2-diethoxyethylamino)-5-oxo-3-phenylpentanoate |
|---|---|
| PubChem CID | 14938942 |
| Molecular Formula | C23H24F5NO5 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-(2,2-diethoxyethylamino)-5-oxo-3-phenylpentanoate |
| SMILES | CCOC(CNC(=O)CC(CC(=O)Oc1c(F)c(F)c(F)c(F)c1F)c1ccccc1)OCC |
| InChI | InChI=1S/C23H24F5NO5/c1-3-32-17(33-4-2)12-29-15(30)10-14(13-8-6-5-7-9-13)11-16(31)34-23-21(27)19(25)18(24)20(26)22(23)28/h5-9,14,17H,3-4,10-12H2,1-2H3,(H,29,30) |
| InChIKey | BBICCROLGXPRQH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|