About 2-(3-aminophenyl)ethanol
2-(3-aminophenyl)ethanol (PubChem CID 14938987) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-(3-aminophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(3-aminophenyl)ethanol |
| PubChem CID | 14938987 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-(3-aminophenyl)ethanol |
| SMILES | Nc1cccc(CCO)c1 |
| InChI | InChI=1S/C8H11NO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5,9H2 |
| InChIKey | FNUKLSVGSFFSLI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenyl)ethanol?
The IUPAC name of 2-(3-aminophenyl)ethanol (CID 14938987) is 2-(3-aminophenyl)ethanol.
What is the SMILES notation for 2-(3-aminophenyl)ethanol?
The canonical SMILES for 2-(3-aminophenyl)ethanol is Nc1cccc(CCO)c1.
What is the InChIKey of 2-(3-aminophenyl)ethanol?
The InChIKey is FNUKLSVGSFFSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5,9H2.
What are the key properties of 2-(3-aminophenyl)ethanol?
2-(3-aminophenyl)ethanol has a molecular weight of 137.18 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenyl)ethanol is sourced from PubChem (CID 14938987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).