C15H21F3N2O — CID 149390426
(3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 149390426) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is (3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | (3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 149390426 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1C[C@H](N)C(=O)N(CC(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C15H21F3N2O/c1-4-5-6-7-10(2)12-8-13(19)14(21)20(11(12)3)9-15(16,17)18/h4-7,11-13H,2,8-9,19H2,1,3H3/b5-4-,7-6-/t11-,12+,13+/m1/s1 |
| InChIKey | YNKJDEOLUGKJAW-GVKJJDKASA-N |
| XLogP | 2.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|