C13H9F6NO2 — CID 14939051
N-[1,1,1-trifluoro-3-formyl-2-(trifluoromethyl)but-3-en-2-yl]benzamide (PubChem CID 14939051) has the molecular formula C13H9F6NO2 and a molecular weight of 325.21 g/mol. Its IUPAC name is N-[1,1,1-trifluoro-3-formyl-2-(trifluoromethyl)but-3-en-2-yl]benzamide.
| Compound Name | N-[1,1,1-trifluoro-3-formyl-2-(trifluoromethyl)but-3-en-2-yl]benzamide |
|---|---|
| PubChem CID | 14939051 |
| Molecular Formula | C13H9F6NO2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[1,1,1-trifluoro-3-formyl-2-(trifluoromethyl)but-3-en-2-yl]benzamide |
| SMILES | C=C(C=O)C(NC(=O)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F6NO2/c1-8(7-21)11(12(14,15)16,13(17,18)19)20-10(22)9-5-3-2-4-6-9/h2-7H,1H2,(H,20,22) |
| InChIKey | NBGNARZFBKYGGB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|