C22H20N2O — CID 14939098
(4R,5R)-2-(4-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole (PubChem CID 14939098) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (4R,5R)-2-(4-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5R)-2-(4-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 14939098 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (4R,5R)-2-(4-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C22H20N2O/c1-25-19-14-12-18(13-15-19)22-23-20(16-8-4-2-5-9-16)21(24-22)17-10-6-3-7-11-17/h2-15,20-21H,1H3,(H,23,24)/t20-,21-/m1/s1 |
| InChIKey | TVCGYCFXGHIRAF-NHCUHLMSSA-N |
| XLogP | 4.53 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |