C24H22F3N3O2S — CID 149393221
2-[[(1R)-4-[5-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-1,2,4-oxadiazol-3-yl]-2,3,7,7a-tetrahydro-1H-inden-1-yl]amino]ethanol (PubChem CID 149393221) has the molecular formula C24H22F3N3O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is 2-[[(1R)-4-[5-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-1,2,4-oxadiazol-3-yl]-2,3,7,7a-tetrahydro-1H-inden-1-yl]amino]ethanol.
| Compound Name | 2-[[(1R)-4-[5-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-1,2,4-oxadiazol-3-yl]-2,3,7,7a-tetrahydro-1H-inden-1-yl]amino]ethanol |
|---|---|
| PubChem CID | 149393221 |
| Molecular Formula | C24H22F3N3O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-[[(1R)-4-[5-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-1,2,4-oxadiazol-3-yl]-2,3,7,7a-tetrahydro-1H-inden-1-yl]amino]ethanol |
| SMILES | OCCN[C@@H]1CCC2=C(c3noc(-c4cc(-c5ccccc5)c(C(F)(F)F)s4)n3)C=CCC21 |
| InChI | InChI=1S/C24H22F3N3O2S/c25-24(26,27)21-18(14-5-2-1-3-6-14)13-20(33-21)23-29-22(30-32-23)17-8-4-7-16-15(17)9-10-19(16)28-11-12-31/h1-6,8,13,16,19,28,31H,7,9-12H2/t16?,19-/m1/s1 |
| InChIKey | YNYDFXYUVDPNAU-LRTDYKAYSA-N |
| XLogP | 5.56 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |