C10H14N2O2 — CID 149399042
2,3,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine-1,4-dione (PubChem CID 149399042) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2,3,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine-1,4-dione.
| Compound Name | 2,3,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine-1,4-dione |
|---|---|
| PubChem CID | 149399042 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2,3,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine-1,4-dione |
| SMILES | O=C1NNC(=O)C2CCCCCC=C12 |
| InChI | InChI=1S/C10H14N2O2/c13-9-7-5-3-1-2-4-6-8(7)10(14)12-11-9/h5,8H,1-4,6H2,(H,11,13)(H,12,14) |
| InChIKey | YPACQINTGRDDJA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |