About 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine
4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine (PubChem CID 149400210) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine.
Molecular Properties
| Compound Name | 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine |
| PubChem CID | 149400210 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine |
| SMILES | CC(C)N1CCN=C(N)C1 |
| InChI | InChI=1S/C7H15N3/c1-6(2)10-4-3-9-7(8)5-10/h6H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | YPFYCCRPRKHGQG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine?
The IUPAC name of 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine (CID 149400210) is 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine.
What is the SMILES notation for 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine?
The canonical SMILES for 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine is CC(C)N1CCN=C(N)C1.
What is the InChIKey of 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine?
The InChIKey is YPFYCCRPRKHGQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-6(2)10-4-3-9-7(8)5-10/h6H,3-5H2,1-2H3,(H2,8,9).
What are the key properties of 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine?
4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine has a molecular weight of 141.22 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-3,5-dihydro-2H-pyrazin-6-amine is sourced from PubChem (CID 149400210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).