C8H9IN2OS — CID 14940029
3-(iodomethyl)-5-methyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 14940029) has the molecular formula C8H9IN2OS and a molecular weight of 308.14 g/mol. Its IUPAC name is 3-(iodomethyl)-5-methyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 3-(iodomethyl)-5-methyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 14940029 |
| Molecular Formula | C8H9IN2OS |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | 3-(iodomethyl)-5-methyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)nc2n1C(CI)CS2 |
| InChI | InChI=1S/C8H9IN2OS/c1-5-2-7(12)10-8-11(5)6(3-9)4-13-8/h2,6H,3-4H2,1H3 |
| InChIKey | IQWDAJXJLDOCEG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|