About 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide
2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide (PubChem CID 149401949) has the molecular formula C20H17N7O5
and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide |
| PubChem CID | 149401949 |
| Molecular Formula | C20H17N7O5 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide |
| SMILES | CCOc1ccc(-c2nc(C(N)=NO)c3[nH]c(=O)n(-c4cccc([N+](=O)[O-])c4)c3n2)cc1 |
| InChI | InChI=1S/C20H17N7O5/c1-2-32-14-8-6-11(7-9-14)18-22-15(17(21)25-29)16-19(24-18)26(20(28)23-16)12-4-3-5-13(10-12)27(30)31/h3-10,29H,2H2,1H3,(H2,21,25)(H,23,28) |
| InChIKey | YPOKRDUHEXWVRF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 174.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide?
The IUPAC name of 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide (CID 149401949) is 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide.
What is the SMILES notation for 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide?
The canonical SMILES for 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide is CCOc1ccc(-c2nc(C(N)=NO)c3[nH]c(=O)n(-c4cccc([N+](=O)[O-])c4)c3n2)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide?
The InChIKey is YPOKRDUHEXWVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N7O5/c1-2-32-14-8-6-11(7-9-14)18-22-15(17(21)25-29)16-19(24-18)26(20(28)23-16)12-4-3-5-13(10-12)27(30)31/h3-10,29H,2H2,1H3,(H2,21,25)(H,23,28).
What are the key properties of 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide?
2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide has a molecular weight of 435.40 g/mol, XLogP of 2.18, 6 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-N'-hydroxy-9-(3-nitrophenyl)-8-oxo-7H-purine-6-carboximidamide is sourced from PubChem (CID 149401949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).