About CID 14940268
CID 14940268 (PubChem CID 14940268) has the molecular formula C16H44Sb2Si4
and a molecular weight of 592.39 g/mol.
Molecular Properties
| Compound Name | CID 14940268 |
| PubChem CID | 14940268 |
| Molecular Formula | C16H44Sb2Si4 |
| Molecular Weight | 592.39 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)C[Sb]C[Si](C)(C)C.C[Si](C)(C)C[Sb]C[Si](C)(C)C |
| InChI | InChI=1S/4C4H11Si.2Sb/c4*1-5(2,3)4;;/h4*1H2,2-4H3;; |
| InChIKey | SVYTZPGDVVHKSP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.39 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 14940268 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14940268?
The IUPAC name of CID 14940268 (CID 14940268) is not available.
What is the SMILES notation for CID 14940268?
The canonical SMILES for CID 14940268 is C[Si](C)(C)C[Sb]C[Si](C)(C)C.C[Si](C)(C)C[Sb]C[Si](C)(C)C.
What is the InChIKey of CID 14940268?
The InChIKey is SVYTZPGDVVHKSP-UHFFFAOYSA-N. The full InChI is InChI=1S/4C4H11Si.2Sb/c4*1-5(2,3)4;;/h4*1H2,2-4H3;;.
What are the key properties of CID 14940268?
CID 14940268 has a molecular weight of 592.39 g/mol, XLogP of 6.56, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14940268 is sourced from PubChem (CID 14940268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).