C20H31N3O6S — CID 149402773
(4R)-4-amino-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 149402773) has the molecular formula C20H31N3O6S and a molecular weight of 441.55 g/mol. Its IUPAC name is (4R)-4-amino-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-4-amino-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 149402773 |
| Molecular Formula | C20H31N3O6S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (4R)-4-amino-2-(1,1-diethoxyethyl)-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | CCC[C@@H](NC(=O)[C@]1(N)CSC(C(C)(OCC)OCC)=N1)c1cc(OC)cc(=O)o1 |
| InChI | InChI=1S/C20H31N3O6S/c1-6-9-14(15-10-13(26-5)11-16(24)29-15)22-17(25)20(21)12-30-18(23-20)19(4,27-7-2)28-8-3/h10-11,14H,6-9,12,21H2,1-5H3,(H,22,25)/t14-,20+/m1/s1 |
| InChIKey | YPSIXFSKWJTJJY-VLIAUNLRSA-N |
| XLogP | 2.20 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|