C14H11O4P — CID 14940416
11-methyl-11-oxobenzo[d][1,3,2]benzodioxaphosphocin-5-one (PubChem CID 14940416) has the molecular formula C14H11O4P and a molecular weight of 274.21 g/mol. Its IUPAC name is 11-methyl-11-oxobenzo[d][1,3,2]benzodioxaphosphocin-5-one.
| Compound Name | 11-methyl-11-oxobenzo[d][1,3,2]benzodioxaphosphocin-5-one |
|---|---|
| PubChem CID | 14940416 |
| Molecular Formula | C14H11O4P |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 11-methyl-11-oxobenzo[d][1,3,2]benzodioxaphosphocin-5-one |
| SMILES | CP1(=O)Oc2ccccc2C(=O)c2ccccc2O1 |
| InChI | InChI=1S/C14H11O4P/c1-19(16)17-12-8-4-2-6-10(12)14(15)11-7-3-5-9-13(11)18-19/h2-9H,1H3 |
| InChIKey | PINPGRALUBEQHW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|