C29H54O3Si — CID 149406360
(6Z,8aR,9S,10R,11aS)-9-[3-[tert-butyl(dimethyl)silyl]oxydecyl]-10-methyl-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one (PubChem CID 149406360) has the molecular formula C29H54O3Si and a molecular weight of 478.83 g/mol. Its IUPAC name is (6Z,8aR,9S,10R,11aS)-9-[3-[tert-butyl(dimethyl)silyl]oxydecyl]-10-methyl-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one.
| Compound Name | (6Z,8aR,9S,10R,11aS)-9-[3-[tert-butyl(dimethyl)silyl]oxydecyl]-10-methyl-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
|---|---|
| PubChem CID | 149406360 |
| Molecular Formula | C29H54O3Si |
| Molecular Weight | 478.83 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | (6Z,8aR,9S,10R,11aS)-9-[3-[tert-butyl(dimethyl)silyl]oxydecyl]-10-methyl-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
| SMILES | CCCCCCCC(CC[C@@H]1[C@H]2C/C=C\CCCC(=O)O[C@H]2C[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O3Si/c1-8-9-10-11-14-17-24(32-33(6,7)29(3,4)5)20-21-25-23(2)22-27-26(25)18-15-12-13-16-19-28(30)31-27/h12,15,23-27H,8-11,13-14,16-22H2,1-7H3/b15-12-/t23-,24?,25+,26-,27+/m1/s1 |
| InChIKey | YQJIQCKXCCCLJN-JIKSQGCVSA-N |
| XLogP | 8.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.83 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|