C10H19IO — CID 14940639
(2R,3R,4S,5R)-2-butyl-3-iodo-4,5-dimethyloxolane (PubChem CID 14940639) has the molecular formula C10H19IO and a molecular weight of 282.17 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-butyl-3-iodo-4,5-dimethyloxolane.
| Compound Name | (2R,3R,4S,5R)-2-butyl-3-iodo-4,5-dimethyloxolane |
|---|---|
| PubChem CID | 14940639 |
| Molecular Formula | C10H19IO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (2R,3R,4S,5R)-2-butyl-3-iodo-4,5-dimethyloxolane |
| SMILES | CCCC[C@H]1O[C@H](C)[C@H](C)[C@H]1I |
| InChI | InChI=1S/C10H19IO/c1-4-5-6-9-10(11)7(2)8(3)12-9/h7-10H,4-6H2,1-3H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | RRFHDPCPRGBEAR-SGIHWFKDSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|