About 4,7-diphenyl-1H-indene
4,7-diphenyl-1H-indene (PubChem CID 14940861) has the molecular formula C21H16
and a molecular weight of 268.36 g/mol. Its IUPAC name is 4,7-diphenyl-1H-indene.
Molecular Properties
| Compound Name | 4,7-diphenyl-1H-indene |
| PubChem CID | 14940861 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4,7-diphenyl-1H-indene |
| SMILES | C1=Cc2c(-c3ccccc3)ccc(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C21H16/c1-3-8-16(9-4-1)18-14-15-19(17-10-5-2-6-11-17)21-13-7-12-20(18)21/h1-12,14-15H,13H2 |
| InChIKey | AKHFVFALPIWERG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,7-diphenyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diphenyl-1H-indene?
The IUPAC name of 4,7-diphenyl-1H-indene (CID 14940861) is 4,7-diphenyl-1H-indene.
What is the SMILES notation for 4,7-diphenyl-1H-indene?
The canonical SMILES for 4,7-diphenyl-1H-indene is C1=Cc2c(-c3ccccc3)ccc(-c3ccccc3)c2C1.
What is the InChIKey of 4,7-diphenyl-1H-indene?
The InChIKey is AKHFVFALPIWERG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16/c1-3-8-16(9-4-1)18-14-15-19(17-10-5-2-6-11-17)21-13-7-12-20(18)21/h1-12,14-15H,13H2.
What are the key properties of 4,7-diphenyl-1H-indene?
4,7-diphenyl-1H-indene has a molecular weight of 268.36 g/mol, XLogP of 5.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diphenyl-1H-indene is sourced from PubChem (CID 14940861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).