C13H12O5 — CID 14940974
6,6-dimethyl-2-phenyl-1,5,7-trioxaspiro[2.5]octane-4,8-dione (PubChem CID 14940974) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 6,6-dimethyl-2-phenyl-1,5,7-trioxaspiro[2.5]octane-4,8-dione.
| Compound Name | 6,6-dimethyl-2-phenyl-1,5,7-trioxaspiro[2.5]octane-4,8-dione |
|---|---|
| PubChem CID | 14940974 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 6,6-dimethyl-2-phenyl-1,5,7-trioxaspiro[2.5]octane-4,8-dione |
| SMILES | CC1(C)OC(=O)C2(OC2c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C13H12O5/c1-12(2)17-10(14)13(11(15)18-12)9(16-13)8-6-4-3-5-7-8/h3-7,9H,1-2H3 |
| InChIKey | NKXYDBCVBIWVJQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|