C27H39N — CID 14941339
4,6,10,12-tetratert-butyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3,5,7,9,11-hexaene (PubChem CID 14941339) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is 4,6,10,12-tetratert-butyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3,5,7,9,11-hexaene.
| Compound Name | 4,6,10,12-tetratert-butyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 14941339 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 4,6,10,12-tetratert-butyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3,5,7,9,11-hexaene |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)=c2cc3c(nc21)=C(C(C)(C)C)C=C3C(C)(C)C |
| InChI | InChI=1S/C27H39N/c1-24(2,3)18-14-20(26(7,8)9)22-16(18)13-17-19(25(4,5)6)15-21(23(17)28-22)27(10,11)12/h13-15H,1-12H3 |
| InChIKey | HLKJARIZLJAGRA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |