C10H15F7 — CID 14941551
1,1,1,2,2,3,3-heptafluoro-7,7-dimethyloctane (PubChem CID 14941551) has the molecular formula C10H15F7 and a molecular weight of 268.22 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-7,7-dimethyloctane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-7,7-dimethyloctane |
|---|---|
| PubChem CID | 14941551 |
| Molecular Formula | C10H15F7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-7,7-dimethyloctane |
| SMILES | CC(C)(C)CCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F7/c1-7(2,3)5-4-6-8(11,12)9(13,14)10(15,16)17/h4-6H2,1-3H3 |
| InChIKey | WMRVAYHMYTZZOT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|