C22H36 — CID 14941603
1-(4-heptylcyclohexyl)-4-propylbenzene (PubChem CID 14941603) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-propylbenzene.
| Compound Name | 1-(4-heptylcyclohexyl)-4-propylbenzene |
|---|---|
| PubChem CID | 14941603 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-propylbenzene |
| SMILES | CCCCCCCC1CCC(c2ccc(CCC)cc2)CC1 |
| InChI | InChI=1S/C22H36/c1-3-5-6-7-8-10-20-13-17-22(18-14-20)21-15-11-19(9-4-2)12-16-21/h11-12,15-16,20,22H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey | MGQBYPPAJLMSBJ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|