C9H6O4S5 — CID 14941678
dimethyl 2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dicarboxylate (PubChem CID 14941678) has the molecular formula C9H6O4S5 and a molecular weight of 338.48 g/mol. Its IUPAC name is dimethyl 2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dicarboxylate.
| Compound Name | dimethyl 2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 14941678 |
| Molecular Formula | C9H6O4S5 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 337.89 |
| IUPAC Name | dimethyl 2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)Sc2sc(=S)sc2S1 |
| InChI | InChI=1S/C9H6O4S5/c1-12-5(10)3-4(6(11)13-2)16-8-7(15-3)17-9(14)18-8/h1-2H3 |
| InChIKey | AJFCJODELNDPJS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|