C26H35NO3 — CID 14941826
butyl (E,2R,6S)-2-[[(1R)-1-phenylethyl]amino]-6-phenylmethoxyhept-4-enoate (PubChem CID 14941826) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is butyl (E,2R,6S)-2-[[(1R)-1-phenylethyl]amino]-6-phenylmethoxyhept-4-enoate.
| Compound Name | butyl (E,2R,6S)-2-[[(1R)-1-phenylethyl]amino]-6-phenylmethoxyhept-4-enoate |
|---|---|
| PubChem CID | 14941826 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | butyl (E,2R,6S)-2-[[(1R)-1-phenylethyl]amino]-6-phenylmethoxyhept-4-enoate |
| SMILES | CCCCOC(=O)[C@@H](C/C=C/[C@H](C)OCc1ccccc1)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H35NO3/c1-4-5-19-29-26(28)25(27-22(3)24-16-10-7-11-17-24)18-12-13-21(2)30-20-23-14-8-6-9-15-23/h6-17,21-22,25,27H,4-5,18-20H2,1-3H3/b13-12+/t21-,22+,25+/m0/s1 |
| InChIKey | NSDHTQRKHKTUTF-SULNHYRMSA-N |
| XLogP | 5.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|