C11H17N — CID 149419695
1-cyclohexa-2,4-dien-1-ylpiperidine (PubChem CID 149419695) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-ylpiperidine.
| Compound Name | 1-cyclohexa-2,4-dien-1-ylpiperidine |
|---|---|
| PubChem CID | 149419695 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-ylpiperidine |
| SMILES | C1=CCC(N2CCCCC2)C=C1 |
| InChI | InChI=1S/C11H17N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-4,7,11H,2,5-6,8-10H2 |
| InChIKey | YSXADIAJMUMEOO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |