C23H44O3Si — CID 149420818
tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane (PubChem CID 149420818) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 149420818 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](CC)[C@@H](OCOC)/C(C)=C/C |
| InChI | InChI=1S/C23H44O3Si/c1-12-15-21(26-27(10,11)23(6,7)8)19(5)16-20(14-3)22(18(4)13-2)25-17-24-9/h12-13,16,20-22H,1,14-15,17H2,2-11H3/b18-13+,19-16+/t20-,21-,22-/m0/s1 |
| InChIKey | YTCRSCDGRBOGBV-PUEVSVSVSA-N |
| XLogP | 6.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|