About ethyl 3-ethenyl-3,7-dimethyloct-6-enoate
ethyl 3-ethenyl-3,7-dimethyloct-6-enoate (PubChem CID 14942085) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is ethyl 3-ethenyl-3,7-dimethyloct-6-enoate.
Molecular Properties
| Compound Name | ethyl 3-ethenyl-3,7-dimethyloct-6-enoate |
| PubChem CID | 14942085 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | ethyl 3-ethenyl-3,7-dimethyloct-6-enoate |
| SMILES | C=CC(C)(CCC=C(C)C)CC(=O)OCC |
| InChI | InChI=1S/C14H24O2/c1-6-14(5,10-8-9-12(3)4)11-13(15)16-7-2/h6,9H,1,7-8,10-11H2,2-5H3 |
| InChIKey | JLGMPDDNGJQNFQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-ethenyl-3,7-dimethyloct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-ethenyl-3,7-dimethyloct-6-enoate?
The IUPAC name of ethyl 3-ethenyl-3,7-dimethyloct-6-enoate (CID 14942085) is ethyl 3-ethenyl-3,7-dimethyloct-6-enoate.
What is the SMILES notation for ethyl 3-ethenyl-3,7-dimethyloct-6-enoate?
The canonical SMILES for ethyl 3-ethenyl-3,7-dimethyloct-6-enoate is C=CC(C)(CCC=C(C)C)CC(=O)OCC.
What is the InChIKey of ethyl 3-ethenyl-3,7-dimethyloct-6-enoate?
The InChIKey is JLGMPDDNGJQNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-6-14(5,10-8-9-12(3)4)11-13(15)16-7-2/h6,9H,1,7-8,10-11H2,2-5H3.
What are the key properties of ethyl 3-ethenyl-3,7-dimethyloct-6-enoate?
ethyl 3-ethenyl-3,7-dimethyloct-6-enoate has a molecular weight of 224.34 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-ethenyl-3,7-dimethyloct-6-enoate is sourced from PubChem (CID 14942085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).