C17H25N — CID 14942450
(4aR,9aR)-9a-butyl-4a-methyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 14942450) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (4aR,9aR)-9a-butyl-4a-methyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | (4aR,9aR)-9a-butyl-4a-methyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 14942450 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (4aR,9aR)-9a-butyl-4a-methyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | CCCC[C@@]12CCCC[C@]1(C)c1ccccc1N2 |
| InChI | InChI=1S/C17H25N/c1-3-4-12-17-13-8-7-11-16(17,2)14-9-5-6-10-15(14)18-17/h5-6,9-10,18H,3-4,7-8,11-13H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | YCIRZPBAYQQMPB-IAGOWNOFSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |