C13H18BNO5S — CID 149424640
2-[(3R,7R)-2-hydroxy-3-[(1-hydroxy-2-thiophen-2-ylethyl)amino]-4,7-dihydro-3H-oxaborepin-7-yl]acetic acid (PubChem CID 149424640) has the molecular formula C13H18BNO5S and a molecular weight of 311.17 g/mol. Its IUPAC name is 2-[(3R,7R)-2-hydroxy-3-[(1-hydroxy-2-thiophen-2-ylethyl)amino]-4,7-dihydro-3H-oxaborepin-7-yl]acetic acid.
| Compound Name | 2-[(3R,7R)-2-hydroxy-3-[(1-hydroxy-2-thiophen-2-ylethyl)amino]-4,7-dihydro-3H-oxaborepin-7-yl]acetic acid |
|---|---|
| PubChem CID | 149424640 |
| Molecular Formula | C13H18BNO5S |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[(3R,7R)-2-hydroxy-3-[(1-hydroxy-2-thiophen-2-ylethyl)amino]-4,7-dihydro-3H-oxaborepin-7-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1C=CC[C@H](NC(O)Cc2cccs2)B(O)O1 |
| InChI | InChI=1S/C13H18BNO5S/c16-12(8-10-4-2-6-21-10)15-11-5-1-3-9(7-13(17)18)20-14(11)19/h1-4,6,9,11-12,15-16,19H,5,7-8H2,(H,17,18)/t9-,11-,12?/m0/s1 |
| InChIKey | YTVVPBYYMPIBSM-HFLPBZFISA-N |
| XLogP | 0.41 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|