C26H36FN3O4S — CID 149425104
propan-2-yl 4-[[6-[4-[ethylidene-(2-methoxyethylamino)-λ4-sulfanyl]-2-fluorophenyl]-3-pyridinyl]oxymethyl]piperidine-1-carboxylate (PubChem CID 149425104) has the molecular formula C26H36FN3O4S and a molecular weight of 505.66 g/mol. Its IUPAC name is propan-2-yl 4-[[6-[4-[ethylidene-(2-methoxyethylamino)-λ4-sulfanyl]-2-fluorophenyl]-3-pyridinyl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[6-[4-[ethylidene-(2-methoxyethylamino)-λ4-sulfanyl]-2-fluorophenyl]-3-pyridinyl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 149425104 |
| Molecular Formula | C26H36FN3O4S |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | propan-2-yl 4-[[6-[4-[ethylidene-(2-methoxyethylamino)-λ4-sulfanyl]-2-fluorophenyl]-3-pyridinyl]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC=S(NCCOC)c1ccc(-c2ccc(OCC3CCN(C(=O)OC(C)C)CC3)cn2)c(F)c1 |
| InChI | InChI=1S/C26H36FN3O4S/c1-5-35(29-12-15-32-4)22-7-8-23(24(27)16-22)25-9-6-21(17-28-25)33-18-20-10-13-30(14-11-20)26(31)34-19(2)3/h5-9,16-17,19-20,29H,10-15,18H2,1-4H3 |
| InChIKey | YTYCCZCDKLUOIZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|