About propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate
propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate (PubChem CID 14942570) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate.
Analyze propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate?
The IUPAC name of propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate (CID 14942570) is propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate.
What is the SMILES notation for propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate?
The canonical SMILES for propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate is CC(C)OC(=O)C1CN=C(c2ccccc2)O1.
What is the InChIKey of propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate?
The InChIKey is JIYDDYHVLRMSJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-9(2)16-13(15)11-8-14-12(17-11)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3.
What are the key properties of propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate?
propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 14942570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).