C16H33N3O2Si — CID 149426365
[(1R,2S)-3-azido-1-[(3R)-5,5-dimethyloxolan-3-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane (PubChem CID 149426365) has the molecular formula C16H33N3O2Si and a molecular weight of 327.55 g/mol. Its IUPAC name is [(1R,2S)-3-azido-1-[(3R)-5,5-dimethyloxolan-3-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S)-3-azido-1-[(3R)-5,5-dimethyloxolan-3-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 149426365 |
| Molecular Formula | C16H33N3O2Si |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | [(1R,2S)-3-azido-1-[(3R)-5,5-dimethyloxolan-3-yl]-2-methylpropoxy]-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](CN=[N+]=[N-])[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)C1 |
| InChI | InChI=1S/C16H33N3O2Si/c1-12(10-18-19-17)14(13-9-16(5,6)20-11-13)21-22(7,8)15(2,3)4/h12-14H,9-11H2,1-8H3/t12-,13+,14+/m0/s1 |
| InChIKey | YUEJGGMAPUEUQN-BFHYXJOUSA-N |
| XLogP | 5.14 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|