About 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid
4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid (PubChem CID 149428703) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid |
| PubChem CID | 149428703 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid |
| SMILES | COC1CC(C(=O)O)CC(OC)C1O |
| InChI | InChI=1S/C9H16O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h5-8,10H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | YUPTUNNQGRXCIO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid?
The IUPAC name of 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid (CID 149428703) is 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid?
The canonical SMILES for 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid is COC1CC(C(=O)O)CC(OC)C1O.
What is the InChIKey of 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid?
The InChIKey is YUPTUNNQGRXCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h5-8,10H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid?
4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid has a molecular weight of 204.22 g/mol, XLogP of -0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3,5-dimethoxycyclohexane-1-carboxylic acid is sourced from PubChem (CID 149428703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).