About [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide
[(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide (PubChem CID 149431522) has the molecular formula C17H13F3N3O2S-
and a molecular weight of 380.37 g/mol. Its IUPAC name is [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide.
Molecular Properties
| Compound Name | [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide |
| PubChem CID | 149431522 |
| Molecular Formula | C17H13F3N3O2S- |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide |
| SMILES | CS(=O)(=O)c1cccc2cc([C@@H]([NH-])C(F)(F)F)c(-c3cccnc3)nc12 |
| InChI | InChI=1S/C17H13F3N3O2S/c1-26(24,25)13-6-2-4-10-8-12(16(21)17(18,19)20)14(23-15(10)13)11-5-3-7-22-9-11/h2-9,16,21H,1H3/q-1/t16-/m1/s1 |
| InChIKey | VZULZRTXDCVKFH-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide?
The IUPAC name of [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide (CID 149431522) is [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide.
What is the SMILES notation for [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide?
The canonical SMILES for [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide is CS(=O)(=O)c1cccc2cc([C@@H]([NH-])C(F)(F)F)c(-c3cccnc3)nc12.
What is the InChIKey of [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide?
The InChIKey is VZULZRTXDCVKFH-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H13F3N3O2S/c1-26(24,25)13-6-2-4-10-8-12(16(21)17(18,19)20)14(23-15(10)13)11-5-3-7-22-9-11/h2-9,16,21H,1H3/q-1/t16-/m1/s1.
What are the key properties of [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide?
[(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide has a molecular weight of 380.37 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2,2,2-trifluoro-1-(8-methylsulfonyl-2-pyridin-3-ylquinolin-3-yl)ethyl]azanide is sourced from PubChem (CID 149431522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).