C26H40OS — CID 149432434
4-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-2-methylbutan-2-ol (PubChem CID 149432434) has the molecular formula C26H40OS and a molecular weight of 400.67 g/mol. Its IUPAC name is 4-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-2-methylbutan-2-ol.
| Compound Name | 4-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 149432434 |
| Molecular Formula | C26H40OS |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 4-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCSCCC1=CC[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40OS/c1-24(2,27)16-18-28-17-13-20-9-11-22-21-10-8-19-7-5-6-14-25(19,3)23(21)12-15-26(20,22)4/h8-10,22-23,27H,5-7,11-18H2,1-4H3/t22-,23-,25-,26+/m0/s1 |
| InChIKey | REBKUGNHGCAUJW-NLJWQWLVSA-N |
| XLogP | 7.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|