About 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid
4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid (PubChem CID 149434235) has the molecular formula C14H10Cl4O4
and a molecular weight of 384.04 g/mol. Its IUPAC name is 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid.
Molecular Properties
| Compound Name | 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid |
| PubChem CID | 149434235 |
| Molecular Formula | C14H10Cl4O4 |
| Molecular Weight | 384.04 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid |
| SMILES | O=C(O)C(Cl)=C(Cl)Cc1ccccc1CC(Cl)=C(Cl)C(=O)O |
| InChI | InChI=1S/C14H10Cl4O4/c15-9(11(17)13(19)20)5-7-3-1-2-4-8(7)6-10(16)12(18)14(21)22/h1-4H,5-6H2,(H,19,20)(H,21,22) |
| InChIKey | HKYOKVYTJWJHJS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid?
The IUPAC name of 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid (CID 149434235) is 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid.
What is the SMILES notation for 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid?
The canonical SMILES for 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid is O=C(O)C(Cl)=C(Cl)Cc1ccccc1CC(Cl)=C(Cl)C(=O)O.
What is the InChIKey of 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid?
The InChIKey is HKYOKVYTJWJHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl4O4/c15-9(11(17)13(19)20)5-7-3-1-2-4-8(7)6-10(16)12(18)14(21)22/h1-4H,5-6H2,(H,19,20)(H,21,22).
What are the key properties of 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid?
4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid has a molecular weight of 384.04 g/mol, XLogP of 4.32, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3-carboxy-2,3-dichloroprop-2-enyl)phenyl]-2,3-dichlorobut-2-enoic acid is sourced from PubChem (CID 149434235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).