About N-(2,2,2-trifluoroacetyl)oxycarbamothioate
N-(2,2,2-trifluoroacetyl)oxycarbamothioate (PubChem CID 149435089) has the molecular formula C3HF3NO3S-
and a molecular weight of 188.11 g/mol. Its IUPAC name is N-(2,2,2-trifluoroacetyl)oxycarbamothioate.
Molecular Properties
| Compound Name | N-(2,2,2-trifluoroacetyl)oxycarbamothioate |
| PubChem CID | 149435089 |
| Molecular Formula | C3HF3NO3S- |
| Molecular Weight | 188.11 g/mol |
| Exact Mass | 187.96 |
| IUPAC Name | N-(2,2,2-trifluoroacetyl)oxycarbamothioate |
| SMILES | O=C([S-])NOC(=O)C(F)(F)F |
| InChI | InChI=1S/C3H2F3NO3S/c4-3(5,6)1(8)10-7-2(9)11/h(H2,7,9,11)/p-1 |
| InChIKey | TTWKJSOQABDKIX-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.11 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2,2-trifluoroacetyl)oxycarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2,2-trifluoroacetyl)oxycarbamothioate?
The IUPAC name of N-(2,2,2-trifluoroacetyl)oxycarbamothioate (CID 149435089) is N-(2,2,2-trifluoroacetyl)oxycarbamothioate.
What is the SMILES notation for N-(2,2,2-trifluoroacetyl)oxycarbamothioate?
The canonical SMILES for N-(2,2,2-trifluoroacetyl)oxycarbamothioate is O=C([S-])NOC(=O)C(F)(F)F.
What is the InChIKey of N-(2,2,2-trifluoroacetyl)oxycarbamothioate?
The InChIKey is TTWKJSOQABDKIX-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H2F3NO3S/c4-3(5,6)1(8)10-7-2(9)11/h(H2,7,9,11)/p-1.
What are the key properties of N-(2,2,2-trifluoroacetyl)oxycarbamothioate?
N-(2,2,2-trifluoroacetyl)oxycarbamothioate has a molecular weight of 188.11 g/mol, XLogP of 0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2,2-trifluoroacetyl)oxycarbamothioate is sourced from PubChem (CID 149435089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).