C21H32O2Si — CID 149435351
(8R,9S,13S,14S)-13-methyl-15-trimethylsilyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 149435351) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-15-trimethylsilyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S)-13-methyl-15-trimethylsilyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 149435351 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-15-trimethylsilyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C([Si](C)(C)C)CC2O |
| InChI | InChI=1S/C21H32O2Si/c1-21-10-9-16-15-8-6-14(22)11-13(15)5-7-17(16)20(21)18(12-19(21)23)24(2,3)4/h6,8,11,16-20,22-23H,5,7,9-10,12H2,1-4H3/t16-,17-,18?,19?,20-,21-/m1/s1 |
| InChIKey | MUSVAZJPJVRWFE-XXGIBWSHSA-N |
| XLogP | 4.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|