About 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one
1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one (PubChem CID 14943541) has the molecular formula C9H16O2S2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one |
| PubChem CID | 14943541 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one |
| SMILES | CCC(=O)[C@]1(CC)SCCCS1=O |
| InChI | InChI=1S/C9H16O2S2/c1-3-8(10)9(4-2)12-6-5-7-13(9)11/h3-7H2,1-2H3/t9-,13?/m1/s1 |
| InChIKey | KJTPFXJYNLWBMA-CGCSKFHYSA-N |
| XLogP | 1.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one?
The IUPAC name of 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one (CID 14943541) is 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one.
What is the SMILES notation for 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one?
The canonical SMILES for 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one is CCC(=O)[C@]1(CC)SCCCS1=O.
What is the InChIKey of 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one?
The InChIKey is KJTPFXJYNLWBMA-CGCSKFHYSA-N. The full InChI is InChI=1S/C9H16O2S2/c1-3-8(10)9(4-2)12-6-5-7-13(9)11/h3-7H2,1-2H3/t9-,13?/m1/s1.
What are the key properties of 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one?
1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one has a molecular weight of 220.36 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one is sourced from PubChem (CID 14943541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).