About 2-azidoprop-2-enal
2-azidoprop-2-enal (PubChem CID 149436796) has the molecular formula C3H3N3O
and a molecular weight of 97.08 g/mol. Its IUPAC name is 2-azidoprop-2-enal.
Molecular Properties
| Compound Name | 2-azidoprop-2-enal |
| PubChem CID | 149436796 |
| Molecular Formula | C3H3N3O |
| Molecular Weight | 97.08 g/mol |
| Exact Mass | 97.03 |
| IUPAC Name | 2-azidoprop-2-enal |
| SMILES | C=C(C=O)N=[N+]=[N-] |
| InChI | InChI=1S/C3H3N3O/c1-3(2-7)5-6-4/h2H,1H2 |
| InChIKey | PGYCORCYVIHXOO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.08 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-azidoprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidoprop-2-enal?
The IUPAC name of 2-azidoprop-2-enal (CID 149436796) is 2-azidoprop-2-enal.
What is the SMILES notation for 2-azidoprop-2-enal?
The canonical SMILES for 2-azidoprop-2-enal is C=C(C=O)N=[N+]=[N-].
What is the InChIKey of 2-azidoprop-2-enal?
The InChIKey is PGYCORCYVIHXOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O/c1-3(2-7)5-6-4/h2H,1H2.
What are the key properties of 2-azidoprop-2-enal?
2-azidoprop-2-enal has a molecular weight of 97.08 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidoprop-2-enal is sourced from PubChem (CID 149436796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).