About 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate
1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate (PubChem CID 149437582) has the molecular formula C20H27N3O4
and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate |
| PubChem CID | 149437582 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate |
| SMILES | CN[C@@H](CCC(N)C(=O)OC(C)(C)C)C(=O)Oc1cnc2ccccc2c1 |
| InChI | InChI=1S/C20H27N3O4/c1-20(2,3)27-18(24)15(21)9-10-17(22-4)19(25)26-14-11-13-7-5-6-8-16(13)23-12-14/h5-8,11-12,15,17,22H,9-10,21H2,1-4H3/t15?,17-/m0/s1 |
| InChIKey | WUSGYDOTMDOGME-LWKPJOBUSA-N |
| XLogP | 2.18 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate?
The IUPAC name of 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate (CID 149437582) is 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate.
What is the SMILES notation for 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate?
The canonical SMILES for 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate is CN[C@@H](CCC(N)C(=O)OC(C)(C)C)C(=O)Oc1cnc2ccccc2c1.
What is the InChIKey of 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate?
The InChIKey is WUSGYDOTMDOGME-LWKPJOBUSA-N. The full InChI is InChI=1S/C20H27N3O4/c1-20(2,3)27-18(24)15(21)9-10-17(22-4)19(25)26-14-11-13-7-5-6-8-16(13)23-12-14/h5-8,11-12,15,17,22H,9-10,21H2,1-4H3/t15?,17-/m0/s1.
What are the key properties of 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate?
1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate has a molecular weight of 373.45 g/mol, XLogP of 2.18, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 6-O-quinolin-3-yl (5S)-2-amino-5-(methylamino)hexanedioate is sourced from PubChem (CID 149437582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).