C7H9F9OSi — CID 14943879
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-trimethylsilane (PubChem CID 14943879) has the molecular formula C7H9F9OSi and a molecular weight of 308.22 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-trimethylsilane.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 14943879 |
| Molecular Formula | C7H9F9OSi |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H9F9OSi/c1-18(2,3)17-4(5(8,9)10,6(11,12)13)7(14,15)16/h1-3H3 |
| InChIKey | YYCHDGHKFDSOOP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|